C15H34N2O6S — CID 138402180
3-(2-ethylhexylsulfamoyl)propanoic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 138402180) has the molecular formula C15H34N2O6S and a molecular weight of 370.51 g/mol. Its IUPAC name is 3-(2-ethylhexylsulfamoyl)propanoic acid;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 3-(2-ethylhexylsulfamoyl)propanoic acid;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 138402180 |
| Molecular Formula | C15H34N2O6S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-(2-ethylhexylsulfamoyl)propanoic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCCCC(CC)CNS(=O)(=O)CCC(=O)O.OCCNCCO |
| InChI | InChI=1S/C11H23NO4S.C4H11NO2/c1-3-5-6-10(4-2)9-12-17(15,16)8-7-11(13)14;6-3-1-5-2-4-7/h10,12H,3-9H2,1-2H3,(H,13,14);5-7H,1-4H2 |
| InChIKey | WTAZBXQKVAEZHC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|