C24H36O4 — CID 138404432
2-[(1S,2S,3E,7Z,11E)-2-acetyloxy-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enyl acetate (PubChem CID 138404432) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[(1S,2S,3E,7Z,11E)-2-acetyloxy-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enyl acetate.
| Compound Name | 2-[(1S,2S,3E,7Z,11E)-2-acetyloxy-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enyl acetate |
|---|---|
| PubChem CID | 138404432 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[(1S,2S,3E,7Z,11E)-2-acetyloxy-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)[C@@H]1CC/C(C)=C/CC/C(C)=C\CC/C(C)=C/[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O4/c1-17-9-7-11-18(2)13-14-23(20(4)16-27-21(5)25)24(28-22(6)26)15-19(3)12-8-10-17/h10-11,15,23-24H,4,7-9,12-14,16H2,1-3,5-6H3/b17-10-,18-11+,19-15+/t23-,24-/m0/s1 |
| InChIKey | YBPOQSGQBJVMKO-SYQFDSCPSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|