C7H19N3 — CID 138454344
N'-(3-aminopropyl)-N,N,1,1,2,2,3,3-octadeuteriobutane-1,4-diamine (PubChem CID 138454344) has the molecular formula C7H19N3 and a molecular weight of 153.30 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N,N,1,1,2,2,3,3-octadeuteriobutane-1,4-diamine.
| Compound Name | N'-(3-aminopropyl)-N,N,1,1,2,2,3,3-octadeuteriobutane-1,4-diamine |
|---|---|
| PubChem CID | 138454344 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 153.30 g/mol |
| Exact Mass | 153.21 |
| IUPAC Name | N'-(3-aminopropyl)-N,N,1,1,2,2,3,3-octadeuteriobutane-1,4-diamine |
| SMILES | [2H]N([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CNCCCN |
| InChI | InChI=1S/C7H19N3/c8-4-1-2-6-10-7-3-5-9/h10H,1-9H2/i1D2,2D2,4D2/hD2 |
| InChIKey | ATHGHQPFGPMSJY-JTWCLIAZSA-N |
| XLogP | -0.34 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|