About ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate
ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate (PubChem CID 138454407) has the molecular formula C11H11NO5
and a molecular weight of 237.21 g/mol. Its IUPAC name is ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate.
Molecular Properties
| Compound Name | ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate |
| PubChem CID | 138454407 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate |
| SMILES | CCOC(=O)C(=CC=Cc1ccco1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO5/c1-2-16-11(13)10(12(14)15)7-3-5-9-6-4-8-17-9/h3-8H,2H2,1H3 |
| InChIKey | RDXYIMUHWRTFAE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate?
The IUPAC name of ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate (CID 138454407) is ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate.
What is the SMILES notation for ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate?
The canonical SMILES for ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate is CCOC(=O)C(=CC=Cc1ccco1)[N+](=O)[O-].
What is the InChIKey of ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate?
The InChIKey is RDXYIMUHWRTFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5/c1-2-16-11(13)10(12(14)15)7-3-5-9-6-4-8-17-9/h3-8H,2H2,1H3.
What are the key properties of ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate?
ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate has a molecular weight of 237.21 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(furan-2-yl)-2-nitropenta-2,4-dienoate is sourced from PubChem (CID 138454407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).