C12H13ClN2S3 — CID 138454431
2-(butyldisulfanyl)-5-(4-chlorophenyl)-1,3,4-thiadiazole (PubChem CID 138454431) has the molecular formula C12H13ClN2S3 and a molecular weight of 316.90 g/mol. Its IUPAC name is 2-(butyldisulfanyl)-5-(4-chlorophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(butyldisulfanyl)-5-(4-chlorophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 138454431 |
| Molecular Formula | C12H13ClN2S3 |
| Molecular Weight | 316.90 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2-(butyldisulfanyl)-5-(4-chlorophenyl)-1,3,4-thiadiazole |
| SMILES | CCCCSSc1nnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C12H13ClN2S3/c1-2-3-8-16-18-12-15-14-11(17-12)9-4-6-10(13)7-5-9/h4-7H,2-3,8H2,1H3 |
| InChIKey | HWGUAQWTMXKTST-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|