C9H9Cl2N5S — CID 45263106
2-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride (PubChem CID 45263106) has the molecular formula C9H9Cl2N5S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 45263106 |
| Molecular Formula | C9H9Cl2N5S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C9H8ClN5S.ClH/c10-6-3-1-5(2-4-6)7-14-15-9(16-7)13-8(11)12;/h1-4H,(H4,11,12,13,15);1H |
| InChIKey | HQMXIMIWUVGQKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|