C8H5Cl2N3S — CID 554213
5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 554213) has the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 554213 |
| Molecular Formula | C8H5Cl2N3S |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C8H5Cl2N3S/c9-5-2-1-4(3-6(5)10)7-12-13-8(11)14-7/h1-3H,(H2,11,13) |
| InChIKey | QNVGTVGYFLNBOG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |