C19H13ClFN3O3 — CID 138455364
3-(2-chloro-3-pyridinyl)-5-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methoxymethyl]-1,2-oxazole (PubChem CID 138455364) has the molecular formula C19H13ClFN3O3 and a molecular weight of 385.78 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-5-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methoxymethyl]-1,2-oxazole.
| Compound Name | 3-(2-chloro-3-pyridinyl)-5-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 138455364 |
| Molecular Formula | C19H13ClFN3O3 |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-5-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methoxymethyl]-1,2-oxazole |
| SMILES | Fc1ccccc1-c1cc(COCc2cc(-c3cccnc3Cl)no2)on1 |
| InChI | InChI=1S/C19H13ClFN3O3/c20-19-15(5-3-7-22-19)18-9-13(27-24-18)11-25-10-12-8-17(23-26-12)14-4-1-2-6-16(14)21/h1-9H,10-11H2 |
| InChIKey | JMRPJAFAPYYKTL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|