C54H47Cl — CID 138455798
4-chloro-2-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)propyl]-6,6,12,12-tetramethylindeno[1,2-b]fluorene (PubChem CID 138455798) has the molecular formula C54H47Cl and a molecular weight of 731.42 g/mol. Its IUPAC name is 4-chloro-2-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)propyl]-6,6,12,12-tetramethylindeno[1,2-b]fluorene.
| Compound Name | 4-chloro-2-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)propyl]-6,6,12,12-tetramethylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 138455798 |
| Molecular Formula | C54H47Cl |
| Molecular Weight | 731.42 g/mol |
| Exact Mass | 730.34 |
| IUPAC Name | 4-chloro-2-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)propyl]-6,6,12,12-tetramethylindeno[1,2-b]fluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(C(CCc3ccc(-c4ccccc4)cc3)c3cc(Cl)c4c(c3)C(C)(C)c3cc5c(cc3-4)C(C)(C)c3ccccc3-5)cc21 |
| InChI | InChI=1S/C54H47Cl/c1-52(2)44-18-12-10-16-39(44)41-27-25-36(28-46(41)52)38(26-22-33-20-23-35(24-21-33)34-14-8-7-9-15-34)37-29-49-51(50(55)30-37)43-32-47-42(31-48(43)54(49,5)6)40-17-11-13-19-45(40)53(47,3)4/h7-21,23-25,27-32,38H,22,26H2,1-6H3 |
| InChIKey | MKCXHRXBOBAYBA-UHFFFAOYSA-N |
| XLogP | 14.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.42 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |