C50H41Cl — CID 138455800
8-[1,2-bis(4-phenylphenyl)ethyl]-4-chloro-10,10,12,12-tetramethylindeno[2,1-b]fluorene (PubChem CID 138455800) has the molecular formula C50H41Cl and a molecular weight of 677.33 g/mol. Its IUPAC name is 8-[1,2-bis(4-phenylphenyl)ethyl]-4-chloro-10,10,12,12-tetramethylindeno[2,1-b]fluorene.
| Compound Name | 8-[1,2-bis(4-phenylphenyl)ethyl]-4-chloro-10,10,12,12-tetramethylindeno[2,1-b]fluorene |
|---|---|
| PubChem CID | 138455800 |
| Molecular Formula | C50H41Cl |
| Molecular Weight | 677.33 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | 8-[1,2-bis(4-phenylphenyl)ethyl]-4-chloro-10,10,12,12-tetramethylindeno[2,1-b]fluorene |
| SMILES | CC1(C)c2cc(C(Cc3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)ccc2-c2cc3c(cc21)C(C)(C)c1cccc(Cl)c1-3 |
| InChI | InChI=1S/C50H41Cl/c1-49(2)43-16-11-17-47(51)48(43)42-30-41-39-27-26-38(29-44(39)50(3,4)45(41)31-46(42)49)40(37-24-22-36(23-25-37)34-14-9-6-10-15-34)28-32-18-20-35(21-19-32)33-12-7-5-8-13-33/h5-27,29-31,40H,28H2,1-4H3 |
| InChIKey | FVSSBHSCQCXPAW-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.33 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |