C36H29Cl — CID 138461805
10-chloro-6,6,12,12-tetramethyl-1,3-diphenylindeno[1,2-b]fluorene (PubChem CID 138461805) has the molecular formula C36H29Cl and a molecular weight of 497.08 g/mol. Its IUPAC name is 10-chloro-6,6,12,12-tetramethyl-1,3-diphenylindeno[1,2-b]fluorene.
| Compound Name | 10-chloro-6,6,12,12-tetramethyl-1,3-diphenylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 138461805 |
| Molecular Formula | C36H29Cl |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 10-chloro-6,6,12,12-tetramethyl-1,3-diphenylindeno[1,2-b]fluorene |
| SMILES | CC1(C)c2cc3c(cc2-c2c(Cl)cccc21)C(C)(C)c1c(-c2ccccc2)cc(-c2ccccc2)cc1-3 |
| InChI | InChI=1S/C36H29Cl/c1-35(2)29-16-11-17-32(37)33(29)28-21-30-26(20-31(28)35)27-19-24(22-12-7-5-8-13-22)18-25(34(27)36(30,3)4)23-14-9-6-10-15-23/h5-21H,1-4H3 |
| InChIKey | JYETVWKQOKXVSZ-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |