C60H49N — CID 174022173
6,6,12,12-tetramethyl-7,9-diphenyl-N-[(3Z)-4-phenylhexa-1,3,5-trien-3-yl]-N-(4-phenylphenyl)indeno[1,2-b]fluoren-2-amine (PubChem CID 174022173) has the molecular formula C60H49N and a molecular weight of 784.06 g/mol. Its IUPAC name is 6,6,12,12-tetramethyl-7,9-diphenyl-N-[(3Z)-4-phenylhexa-1,3,5-trien-3-yl]-N-(4-phenylphenyl)indeno[1,2-b]fluoren-2-amine.
| Compound Name | 6,6,12,12-tetramethyl-7,9-diphenyl-N-[(3Z)-4-phenylhexa-1,3,5-trien-3-yl]-N-(4-phenylphenyl)indeno[1,2-b]fluoren-2-amine |
|---|---|
| PubChem CID | 174022173 |
| Molecular Formula | C60H49N |
| Molecular Weight | 784.06 g/mol |
| Exact Mass | 783.39 |
| IUPAC Name | 6,6,12,12-tetramethyl-7,9-diphenyl-N-[(3Z)-4-phenylhexa-1,3,5-trien-3-yl]-N-(4-phenylphenyl)indeno[1,2-b]fluoren-2-amine |
| SMILES | C=C/C(=C(\C=C)N(c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1c(-c2ccccc2)cc(-c2ccccc2)cc1-3)c1ccccc1 |
| InChI | InChI=1S/C60H49N/c1-7-48(43-25-17-11-18-26-43)57(8-2)61(46-31-29-42(30-32-46)40-21-13-9-14-22-40)47-33-34-49-51-38-56-52(39-55(51)59(3,4)54(49)37-47)53-36-45(41-23-15-10-16-24-41)35-50(58(53)60(56,5)6)44-27-19-12-20-28-44/h7-39H,1-2H2,3-6H3/b57-48- |
| InChIKey | MKWBKHCHDHBYCZ-RXDNDDQVSA-N |
| XLogP | 16.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.06 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|