C41H41BO2 — CID 174008153
2-[4-[2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174008153) has the molecular formula C41H41BO2 and a molecular weight of 576.59 g/mol. Its IUPAC name is 2-[4-[2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174008153 |
| Molecular Formula | C41H41BO2 |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 2-[4-[2-(9,9-dimethylfluoren-2-yl)-2-(3-phenylphenyl)ethyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)c2ccccc2-c2ccc(C(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3cccc(-c4ccccc4)c3)cc21 |
| InChI | InChI=1S/C41H41BO2/c1-39(2)37-18-11-10-17-34(37)35-24-21-32(27-38(35)39)36(31-16-12-15-30(26-31)29-13-8-7-9-14-29)25-28-19-22-33(23-20-28)42-43-40(3,4)41(5,6)44-42/h7-24,26-27,36H,25H2,1-6H3 |
| InChIKey | SVSAGLLBUFFIBA-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|