C54H49BO2 — CID 66598646
4,4,5,5-tetramethyl-2-[4-[9-[4-[3-[4-(2-methylpropyl)phenyl]-9H-fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]-1,3,2-dioxaborolane (PubChem CID 66598646) has the molecular formula C54H49BO2 and a molecular weight of 740.80 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[9-[4-[3-[4-(2-methylpropyl)phenyl]-9H-fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[9-[4-[3-[4-(2-methylpropyl)phenyl]-9H-fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66598646 |
| Molecular Formula | C54H49BO2 |
| Molecular Weight | 740.80 g/mol |
| Exact Mass | 740.38 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[9-[4-[3-[4-(2-methylpropyl)phenyl]-9H-fluoren-9-yl]phenyl]fluoren-9-yl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)Cc1ccc(-c2ccc3c(c2)-c2ccccc2C3c2ccc(C3(c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C54H49BO2/c1-35(2)33-36-19-21-37(22-20-36)39-25-32-47-48(34-39)43-13-7-8-16-46(43)51(47)38-23-26-40(27-24-38)54(49-17-11-9-14-44(49)45-15-10-12-18-50(45)54)41-28-30-42(31-29-41)55-56-52(3,4)53(5,6)57-55/h7-32,34-35,51H,33H2,1-6H3 |
| InChIKey | JKGPNSXJERWCHS-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.80 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|