C18H24N10O2 — CID 138455892
3-N-[2-[5-[[[5-[2-(2-methylfuran-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 138455892) has the molecular formula C18H24N10O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 3-N-[2-[5-[[[5-[2-(2-methylfuran-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[2-[5-[[[5-[2-(2-methylfuran-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 138455892 |
| Molecular Formula | C18H24N10O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-N-[2-[5-[[[5-[2-(2-methylfuran-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]amino]methyl]furan-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1occc1CCNc1nc(NCc2cc(CCNc3n[nH]c(N)n3)co2)n[nH]1 |
| InChI | InChI=1S/C18H24N10O2/c1-11-13(4-7-29-11)3-6-21-17-24-18(28-27-17)22-9-14-8-12(10-30-14)2-5-20-16-23-15(19)25-26-16/h4,7-8,10H,2-3,5-6,9H2,1H3,(H4,19,20,23,25,26)(H3,21,22,24,27,28) |
| InChIKey | ZSDPOSBSQIIPLJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 171.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |