C17H26N2 — CID 138459829
5-methyl-1-[(4-propan-2-ylphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 138459829) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 5-methyl-1-[(4-propan-2-ylphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 5-methyl-1-[(4-propan-2-ylphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 138459829 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 5-methyl-1-[(4-propan-2-ylphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CC(C)c1ccc(CN2CCC3CN(C)CC32)cc1 |
| InChI | InChI=1S/C17H26N2/c1-13(2)15-6-4-14(5-7-15)10-19-9-8-16-11-18(3)12-17(16)19/h4-7,13,16-17H,8-12H2,1-3H3 |
| InChIKey | HQVPLEOXXXYKFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |