C19H29N — CID 58659517
1-[(4-propan-2-ylphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58659517) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-[(4-propan-2-ylphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-[(4-propan-2-ylphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58659517 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 1-[(4-propan-2-ylphenyl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC(C)c1ccc(CN2CCCC3CCCCC32)cc1 |
| InChI | InChI=1S/C19H29N/c1-15(2)17-11-9-16(10-12-17)14-20-13-5-7-18-6-3-4-8-19(18)20/h9-12,15,18-19H,3-8,13-14H2,1-2H3 |
| InChIKey | XJACYHSMMPFFHG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |