About N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide
N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide (PubChem CID 138459867) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide.
Molecular Properties
| Compound Name | N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
| PubChem CID | 138459867 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide |
| SMILES | C=N/C(C)=N/C=C(C)C |
| InChI | InChI=1S/C7H12N2/c1-6(2)5-9-7(3)8-4/h5H,4H2,1-3H3/b9-7+ |
| InChIKey | PVINGFOFRAAMMJ-VQHVLOKHSA-N |
| XLogP | 2.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The IUPAC name of N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide (CID 138459867) is N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide.
What is the SMILES notation for N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The canonical SMILES for N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide is C=N/C(C)=N/C=C(C)C.
What is the InChIKey of N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
The InChIKey is PVINGFOFRAAMMJ-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H12N2/c1-6(2)5-9-7(3)8-4/h5H,4H2,1-3H3/b9-7+.
What are the key properties of N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide?
N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide has a molecular weight of 124.19 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-(2-methylprop-1-enyl)ethanimidamide is sourced from PubChem (CID 138459867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).