C14H24O5S — CID 138459950
2-prop-2-enoxyethyl 3-(3-ethoxy-3-oxopropyl)sulfanyl-2-methylpropanoate (PubChem CID 138459950) has the molecular formula C14H24O5S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-prop-2-enoxyethyl 3-(3-ethoxy-3-oxopropyl)sulfanyl-2-methylpropanoate.
| Compound Name | 2-prop-2-enoxyethyl 3-(3-ethoxy-3-oxopropyl)sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 138459950 |
| Molecular Formula | C14H24O5S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-prop-2-enoxyethyl 3-(3-ethoxy-3-oxopropyl)sulfanyl-2-methylpropanoate |
| SMILES | C=CCOCCOC(=O)C(C)CSCCC(=O)OCC |
| InChI | InChI=1S/C14H24O5S/c1-4-7-17-8-9-19-14(16)12(3)11-20-10-6-13(15)18-5-2/h4,12H,1,5-11H2,2-3H3 |
| InChIKey | QHGUBVJPFXABOM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|