C13H27N3O — CID 138462120
cis-(1R,2S)-2-(tert-butylamino)-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide (PubChem CID 138462120) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is cis-(1R,2S)-2-(tert-butylamino)-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(tert-butylamino)-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 138462120 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | cis-(1R,2S)-2-(tert-butylamino)-N-[2-(methylamino)ethyl]cyclopentane-1-carboxamide |
| SMILES | CNCCNC(=O)[C@@H]1CCC[C@@H]1NC(C)(C)C |
| InChI | InChI=1S/C13H27N3O/c1-13(2,3)16-11-7-5-6-10(11)12(17)15-9-8-14-4/h10-11,14,16H,5-9H2,1-4H3,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | BSUUBOUXVBXCGP-MNOVXSKESA-N |
| XLogP | 0.88 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|