C17H25N — CID 138463455
(2Z)-1-(4-tert-butyl-2-methylphenyl)-2-ethylidenepyrrolidine (PubChem CID 138463455) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (2Z)-1-(4-tert-butyl-2-methylphenyl)-2-ethylidenepyrrolidine.
| Compound Name | (2Z)-1-(4-tert-butyl-2-methylphenyl)-2-ethylidenepyrrolidine |
|---|---|
| PubChem CID | 138463455 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (2Z)-1-(4-tert-butyl-2-methylphenyl)-2-ethylidenepyrrolidine |
| SMILES | C/C=C1/CCCN1c1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C17H25N/c1-6-15-8-7-11-18(15)16-10-9-14(12-13(16)2)17(3,4)5/h6,9-10,12H,7-8,11H2,1-5H3/b15-6- |
| InChIKey | SXYPZSCLSSPWBN-UUASQNMZSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |