C32H43N4O3P — CID 138464158
2-amino-8-[3-[(Z)-2-[2-[ethoxy(methyl)phosphanyl]ethyl-methylamino]ethenyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 138464158) has the molecular formula C32H43N4O3P and a molecular weight of 562.70 g/mol. Its IUPAC name is 2-amino-8-[3-[(Z)-2-[2-[ethoxy(methyl)phosphanyl]ethyl-methylamino]ethenyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[3-[(Z)-2-[2-[ethoxy(methyl)phosphanyl]ethyl-methylamino]ethenyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 138464158 |
| Molecular Formula | C32H43N4O3P |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 2-amino-8-[3-[(Z)-2-[2-[ethoxy(methyl)phosphanyl]ethyl-methylamino]ethenyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc(C=O)c(/C=C\N(C)CCP(C)OCC)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C32H43N4O3P/c1-6-14-36(15-7-2)32(38)29-20-27-11-9-25(21-30(27)34-31(33)22-29)24-10-12-28(23-37)26(19-24)13-16-35(4)17-18-40(5)39-8-3/h9-13,16,19-21,23H,6-8,14-15,17-18,22H2,1-5H3,(H2,33,34)/b16-13- |
| InChIKey | PRDSXGZKSJFBEZ-SSZFMOIBSA-N |
| XLogP | 6.56 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|