C30H39N11O2 — CID 138464168
2-amino-8-[3-[(Z)-[[3-[amino(methyl)amino]-3-(diazohydrazinylidene)propyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 138464168) has the molecular formula C30H39N11O2 and a molecular weight of 585.72 g/mol. Its IUPAC name is 2-amino-8-[3-[(Z)-[[3-[amino(methyl)amino]-3-(diazohydrazinylidene)propyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[3-[(Z)-[[3-[amino(methyl)amino]-3-(diazohydrazinylidene)propyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 138464168 |
| Molecular Formula | C30H39N11O2 |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 2-amino-8-[3-[(Z)-[[3-[amino(methyl)amino]-3-(diazohydrazinylidene)propyl]-methylhydrazinylidene]methyl]-4-formylphenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc(C=O)c(/C=N\N(C)CCC(=NN=[N+]=[N-])N(C)N)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C30H39N11O2/c1-5-12-41(13-6-2)30(43)25-16-23-9-7-22(17-27(23)35-28(31)18-25)21-8-10-24(20-42)26(15-21)19-34-39(3)14-11-29(40(4)33)36-38-37-32/h7-10,15-17,19-20H,5-6,11-14,18,33H2,1-4H3,(H2,31,35)/b34-19-,36-29? |
| InChIKey | VOCAKLPUJGXWKG-RVJBDBNPSA-N |
| XLogP | 4.68 |
| TPSA | 181.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|