C31H34FN7O2 — CID 138464305
2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(pyrimidin-2-ylmethyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 138464305) has the molecular formula C31H34FN7O2 and a molecular weight of 555.66 g/mol. Its IUPAC name is 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(pyrimidin-2-ylmethyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(pyrimidin-2-ylmethyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 138464305 |
| Molecular Formula | C31H34FN7O2 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 2-amino-6-fluoro-8-[4-formyl-3-[(Z)-[methyl(pyrimidin-2-ylmethyl)hydrazinylidene]methyl]phenyl]-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2c(F)cc(-c3ccc(C=O)c(/C=N\N(C)Cc4ncccn4)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C31H34FN7O2/c1-4-11-39(12-5-2)31(41)24-14-26-27(32)15-23(16-28(26)37-29(33)17-24)21-7-8-22(20-40)25(13-21)18-36-38(3)19-30-34-9-6-10-35-30/h6-10,13-16,18,20H,4-5,11-12,17,19H2,1-3H3,(H2,33,37)/b36-18- |
| InChIKey | ZUGIJUQTFYHZKM-VHFSBPNMSA-N |
| XLogP | 4.99 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|