C14H18N2O2 — CID 138464179
2-[[(Z)-2-(2-formylphenyl)ethenyl]-methylamino]-N,N-dimethylacetamide (PubChem CID 138464179) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[[(Z)-2-(2-formylphenyl)ethenyl]-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(Z)-2-(2-formylphenyl)ethenyl]-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 138464179 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[[(Z)-2-(2-formylphenyl)ethenyl]-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(/C=C\c1ccccc1C=O)CC(=O)N(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-15(2)14(18)10-16(3)9-8-12-6-4-5-7-13(12)11-17/h4-9,11H,10H2,1-3H3/b9-8- |
| InChIKey | CBTBBVCJVVHTNB-HJWRWDBZSA-N |
| XLogP | 1.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|