C18H16FN — CID 138464468
6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline (PubChem CID 138464468) has the molecular formula C18H16FN and a molecular weight of 265.33 g/mol. Its IUPAC name is 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline.
| Compound Name | 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline |
|---|---|
| PubChem CID | 138464468 |
| Molecular Formula | C18H16FN |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline |
| SMILES | Cc1cccc(-c2ccc3c(C)c(F)c(C)cc3n2)c1 |
| InChI | InChI=1S/C18H16FN/c1-11-5-4-6-14(9-11)16-8-7-15-13(3)18(19)12(2)10-17(15)20-16/h4-10H,1-3H3 |
| InChIKey | DTRDJRLSVGWUBV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |