About 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline
6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline (PubChem CID 138464468) has the molecular formula C18H16FN
and a molecular weight of 265.33 g/mol. Its IUPAC name is 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline.
Molecular Properties
| Compound Name | 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline |
| PubChem CID | 138464468 |
| Molecular Formula | C18H16FN |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline |
| SMILES | Cc1cccc(-c2ccc3c(C)c(F)c(C)cc3n2)c1 |
| InChI | InChI=1S/C18H16FN/c1-11-5-4-6-14(9-11)16-8-7-15-13(3)18(19)12(2)10-17(15)20-16/h4-10H,1-3H3 |
| InChIKey | DTRDJRLSVGWUBV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline?
The IUPAC name of 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline (CID 138464468) is 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline.
What is the SMILES notation for 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline?
The canonical SMILES for 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline is Cc1cccc(-c2ccc3c(C)c(F)c(C)cc3n2)c1.
What is the InChIKey of 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline?
The InChIKey is DTRDJRLSVGWUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN/c1-11-5-4-6-14(9-11)16-8-7-15-13(3)18(19)12(2)10-17(15)20-16/h4-10H,1-3H3.
What are the key properties of 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline?
6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline has a molecular weight of 265.33 g/mol, XLogP of 4.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5,7-dimethyl-2-(3-methylphenyl)quinoline is sourced from PubChem (CID 138464468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).