C11H14N4O3 — CID 138467248
N-(2,6-dioxopiperidin-3-yl)-N,1-dimethylpyrazole-4-carboxamide (PubChem CID 138467248) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N,1-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N,1-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138467248 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N,1-dimethylpyrazole-4-carboxamide |
| SMILES | CN(C(=O)c1cnn(C)c1)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H14N4O3/c1-14-6-7(5-12-14)11(18)15(2)8-3-4-9(16)13-10(8)17/h5-6,8H,3-4H2,1-2H3,(H,13,16,17) |
| InChIKey | PJYWESOUWRJEQS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|