C11H14F2N4O2 — CID 90189343
N-(difluoromethyl)-1-methyl-N-[(2S)-pyrrolidine-2-carbonyl]pyrazole-4-carboxamide (PubChem CID 90189343) has the molecular formula C11H14F2N4O2 and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(difluoromethyl)-1-methyl-N-[(2S)-pyrrolidine-2-carbonyl]pyrazole-4-carboxamide.
| Compound Name | N-(difluoromethyl)-1-methyl-N-[(2S)-pyrrolidine-2-carbonyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90189343 |
| Molecular Formula | C11H14F2N4O2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(difluoromethyl)-1-methyl-N-[(2S)-pyrrolidine-2-carbonyl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N(C(=O)[C@@H]2CCCN2)C(F)F)cn1 |
| InChI | InChI=1S/C11H14F2N4O2/c1-16-6-7(5-15-16)9(18)17(11(12)13)10(19)8-3-2-4-14-8/h5-6,8,11,14H,2-4H2,1H3/t8-/m0/s1 |
| InChIKey | DVRCEZSUPVBSAC-QMMMGPOBSA-N |
| XLogP | 0.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|