C9H13F3 — CID 138468401
2,3,4-trimethyl-3-(trifluoromethyl)penta-1,4-diene (PubChem CID 138468401) has the molecular formula C9H13F3 and a molecular weight of 178.20 g/mol. Its IUPAC name is 2,3,4-trimethyl-3-(trifluoromethyl)penta-1,4-diene.
| Compound Name | 2,3,4-trimethyl-3-(trifluoromethyl)penta-1,4-diene |
|---|---|
| PubChem CID | 138468401 |
| Molecular Formula | C9H13F3 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2,3,4-trimethyl-3-(trifluoromethyl)penta-1,4-diene |
| SMILES | C=C(C)C(C)(C(=C)C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3/c1-6(2)8(5,7(3)4)9(10,11)12/h1,3H2,2,4-5H3 |
| InChIKey | KVAMAELRRMEVFX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|