C35H44N6O6 — CID 138470818
(4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-4-methyl-3-[[4-methyl-2-[(2-pyridin-2-ylacetyl)amino]pentanoyl]amino]-2-oxohexanamide (PubChem CID 138470818) has the molecular formula C35H44N6O6 and a molecular weight of 644.77 g/mol. Its IUPAC name is (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-4-methyl-3-[[4-methyl-2-[(2-pyridin-2-ylacetyl)amino]pentanoyl]amino]-2-oxohexanamide.
| Compound Name | (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-4-methyl-3-[[4-methyl-2-[(2-pyridin-2-ylacetyl)amino]pentanoyl]amino]-2-oxohexanamide |
|---|---|
| PubChem CID | 138470818 |
| Molecular Formula | C35H44N6O6 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-4-methyl-3-[[4-methyl-2-[(2-pyridin-2-ylacetyl)amino]pentanoyl]amino]-2-oxohexanamide |
| SMILES | CC[C@H](C)C(NC(=O)C(CC(C)C)NC(=O)Cc1ccccn1)C(=O)C(=O)NCC(=O)NC(Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C35H44N6O6/c1-5-22(4)31(41-34(46)28(16-21(2)3)40-29(42)19-26-12-8-9-15-37-26)32(44)35(47)38-20-30(43)39-27(33(36)45)18-23-13-14-24-10-6-7-11-25(24)17-23/h6-15,17,21-22,27-28,31H,5,16,18-20H2,1-4H3,(H2,36,45)(H,38,47)(H,39,43)(H,40,42)(H,41,46)/t22-,27?,28?,31?/m0/s1 |
| InChIKey | RFLNMSIDAVGFPJ-MSLMFDISSA-N |
| XLogP | 1.74 |
| TPSA | 189.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|