C34H38N6O6 — CID 138470824
(4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-3-[[3-cyano-2-[(2-phenylacetyl)amino]propanoyl]amino]-4-methyl-2-oxohexanamide (PubChem CID 138470824) has the molecular formula C34H38N6O6 and a molecular weight of 626.71 g/mol. Its IUPAC name is (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-3-[[3-cyano-2-[(2-phenylacetyl)amino]propanoyl]amino]-4-methyl-2-oxohexanamide.
| Compound Name | (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-3-[[3-cyano-2-[(2-phenylacetyl)amino]propanoyl]amino]-4-methyl-2-oxohexanamide |
|---|---|
| PubChem CID | 138470824 |
| Molecular Formula | C34H38N6O6 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | (4S)-N-[2-[(1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl)amino]-2-oxoethyl]-3-[[3-cyano-2-[(2-phenylacetyl)amino]propanoyl]amino]-4-methyl-2-oxohexanamide |
| SMILES | CC[C@H](C)C(NC(=O)C(CC#N)NC(=O)Cc1ccccc1)C(=O)C(=O)NCC(=O)NC(Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C34H38N6O6/c1-3-21(2)30(40-33(45)26(15-16-35)38-28(41)19-22-9-5-4-6-10-22)31(43)34(46)37-20-29(42)39-27(32(36)44)18-23-13-14-24-11-7-8-12-25(24)17-23/h4-14,17,21,26-27,30H,3,15,18-20H2,1-2H3,(H2,36,44)(H,37,46)(H,38,41)(H,39,42)(H,40,45)/t21-,26?,27?,30?/m0/s1 |
| InChIKey | LUVAHSUHJJVYHK-ULRARNRBSA-N |
| XLogP | 1.21 |
| TPSA | 200.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|