C19H16N2O3S — CID 138471277
3-methoxy-4-[2-[3-(1,3-thiazol-5-yl)phenoxy]ethoxy]benzonitrile (PubChem CID 138471277) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-methoxy-4-[2-[3-(1,3-thiazol-5-yl)phenoxy]ethoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[2-[3-(1,3-thiazol-5-yl)phenoxy]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 138471277 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-methoxy-4-[2-[3-(1,3-thiazol-5-yl)phenoxy]ethoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCCOc1cccc(-c2cncs2)c1 |
| InChI | InChI=1S/C19H16N2O3S/c1-22-18-9-14(11-20)5-6-17(18)24-8-7-23-16-4-2-3-15(10-16)19-12-21-13-25-19/h2-6,9-10,12-13H,7-8H2,1H3 |
| InChIKey | JQUZTYJSEDQHHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|