C24H27N3O3 — CID 142544647
4-[2-[3-(2-cyclopropylimidazol-1-yl)phenoxy]ethoxy]-3-methoxybenzonitrile;ethane (PubChem CID 142544647) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[2-[3-(2-cyclopropylimidazol-1-yl)phenoxy]ethoxy]-3-methoxybenzonitrile;ethane.
| Compound Name | 4-[2-[3-(2-cyclopropylimidazol-1-yl)phenoxy]ethoxy]-3-methoxybenzonitrile;ethane |
|---|---|
| PubChem CID | 142544647 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-[2-[3-(2-cyclopropylimidazol-1-yl)phenoxy]ethoxy]-3-methoxybenzonitrile;ethane |
| SMILES | CC.COc1cc(C#N)ccc1OCCOc1cccc(-n2ccnc2C2CC2)c1 |
| InChI | InChI=1S/C22H21N3O3.C2H6/c1-26-21-13-16(15-23)5-8-20(21)28-12-11-27-19-4-2-3-18(14-19)25-10-9-24-22(25)17-6-7-17;1-2/h2-5,8-10,13-14,17H,6-7,11-12H2,1H3;1-2H3 |
| InChIKey | ABRUFPXIDHXHBR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|