C22H21N3O6 — CID 56925899
3-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-4-[3-(2-methoxyethoxy)phenoxy]benzonitrile (PubChem CID 56925899) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-4-[3-(2-methoxyethoxy)phenoxy]benzonitrile.
| Compound Name | 3-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-4-[3-(2-methoxyethoxy)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 56925899 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]-4-[3-(2-methoxyethoxy)phenoxy]benzonitrile |
| SMILES | COCCOc1cccc(Oc2ccc(C#N)cc2OCCn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C22H21N3O6/c1-28-11-12-29-17-3-2-4-18(14-17)31-19-6-5-16(15-23)13-20(19)30-10-9-25-8-7-21(26)24-22(25)27/h2-8,13-14H,9-12H2,1H3,(H,24,26,27) |
| InChIKey | VZLGYCVNGYJMRD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|