C14H20FNO3 — CID 138473175
[5-[(1R)-2-(butylamino)-1-hydroxyethyl]-2-fluorophenyl] acetate (PubChem CID 138473175) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is [5-[(1R)-2-(butylamino)-1-hydroxyethyl]-2-fluorophenyl] acetate.
| Compound Name | [5-[(1R)-2-(butylamino)-1-hydroxyethyl]-2-fluorophenyl] acetate |
|---|---|
| PubChem CID | 138473175 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [5-[(1R)-2-(butylamino)-1-hydroxyethyl]-2-fluorophenyl] acetate |
| SMILES | CCCCNC[C@H](O)c1ccc(F)c(OC(C)=O)c1 |
| InChI | InChI=1S/C14H20FNO3/c1-3-4-7-16-9-13(18)11-5-6-12(15)14(8-11)19-10(2)17/h5-6,8,13,16,18H,3-4,7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | KZTSKAOAFHGRRH-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|