C30H42Cl2N2O10 — CID 21438077
[3-acetyloxy-5-[2-[6-[[2-(3,5-diacetyloxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]phenyl] acetate;dihydrochloride (PubChem CID 21438077) has the molecular formula C30H42Cl2N2O10 and a molecular weight of 661.58 g/mol. Its IUPAC name is [3-acetyloxy-5-[2-[6-[[2-(3,5-diacetyloxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]phenyl] acetate;dihydrochloride.
| Compound Name | [3-acetyloxy-5-[2-[6-[[2-(3,5-diacetyloxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]phenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 21438077 |
| Molecular Formula | C30H42Cl2N2O10 |
| Molecular Weight | 661.58 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | [3-acetyloxy-5-[2-[6-[[2-(3,5-diacetyloxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]phenyl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(O)CNCCCCCCNCC(O)c2cc(OC(C)=O)cc(OC(C)=O)c2)c1.Cl.Cl |
| InChI | InChI=1S/C30H40N2O10.2ClH/c1-19(33)39-25-11-23(12-26(15-25)40-20(2)34)29(37)17-31-9-7-5-6-8-10-32-18-30(38)24-13-27(41-21(3)35)16-28(14-24)42-22(4)36;;/h11-16,29-32,37-38H,5-10,17-18H2,1-4H3;2*1H |
| InChIKey | OPSAZLFRVFNAPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|