C9H13F3O2 — CID 138473241
methyl 2-methyl-2-(1,2,2-trifluoroethyl)pent-4-enoate (PubChem CID 138473241) has the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 2-methyl-2-(1,2,2-trifluoroethyl)pent-4-enoate.
| Compound Name | methyl 2-methyl-2-(1,2,2-trifluoroethyl)pent-4-enoate |
|---|---|
| PubChem CID | 138473241 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | methyl 2-methyl-2-(1,2,2-trifluoroethyl)pent-4-enoate |
| SMILES | C=CCC(C)(C(=O)OC)C(F)C(F)F |
| InChI | InChI=1S/C9H13F3O2/c1-4-5-9(2,8(13)14-3)6(10)7(11)12/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | QWKQFVOLNIPHRJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|