C21H20ClF4NO3 — CID 138473864
[3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-[3-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 138473864) has the molecular formula C21H20ClF4NO3 and a molecular weight of 445.84 g/mol. Its IUPAC name is [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-[3-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-[3-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 138473864 |
| Molecular Formula | C21H20ClF4NO3 |
| Molecular Weight | 445.84 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-[3-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCCOC(F)(F)F)c(Cl)c1)N1CCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H20ClF4NO3/c22-18-12-15(5-8-19(18)29-10-11-30-21(24,25)26)20(28)27-9-1-2-16(13-27)14-3-6-17(23)7-4-14/h3-8,12,16H,1-2,9-11,13H2 |
| InChIKey | NZEKZDSTRXTMEP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|