C21H20ClF3N2O3 — CID 121387486
[3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-(6-pyridin-2-yl-3-azabicyclo[4.1.0]heptan-3-yl)methanone (PubChem CID 121387486) has the molecular formula C21H20ClF3N2O3 and a molecular weight of 440.85 g/mol. Its IUPAC name is [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-(6-pyridin-2-yl-3-azabicyclo[4.1.0]heptan-3-yl)methanone.
| Compound Name | [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-(6-pyridin-2-yl-3-azabicyclo[4.1.0]heptan-3-yl)methanone |
|---|---|
| PubChem CID | 121387486 |
| Molecular Formula | C21H20ClF3N2O3 |
| Molecular Weight | 440.85 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [3-chloro-4-[2-(trifluoromethoxy)ethoxy]phenyl]-(6-pyridin-2-yl-3-azabicyclo[4.1.0]heptan-3-yl)methanone |
| SMILES | O=C(c1ccc(OCCOC(F)(F)F)c(Cl)c1)N1CCC2(c3ccccn3)CC2C1 |
| InChI | InChI=1S/C21H20ClF3N2O3/c22-16-11-14(4-5-17(16)29-9-10-30-21(23,24)25)19(28)27-8-6-20(12-15(20)13-27)18-3-1-2-7-26-18/h1-5,7,11,15H,6,8-10,12-13H2 |
| InChIKey | WAYRXMSHXIAFIH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|