C26H30F3NO4 — CID 138474007
[(4aR,8aS)-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 138474007) has the molecular formula C26H30F3NO4 and a molecular weight of 477.52 g/mol. Its IUPAC name is [(4aR,8aS)-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [(4aR,8aS)-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 138474007 |
| Molecular Formula | C26H30F3NO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | [(4aR,8aS)-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@]3(c4ccccc4)CCCC[C@@H]3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C26H30F3NO4/c1-32-23-17-19(10-11-22(23)33-15-16-34-26(27,28)29)24(31)30-14-13-25(20-7-3-2-4-8-20)12-6-5-9-21(25)18-30/h2-4,7-8,10-11,17,21H,5-6,9,12-16,18H2,1H3/t21-,25+/m1/s1 |
| InChIKey | BBNUIIDAWZFMOL-BWKNWUBXSA-N |
| XLogP | 5.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|