C23H23F4NO6 — CID 121387471
[(7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 121387471) has the molecular formula C23H23F4NO6 and a molecular weight of 485.43 g/mol. Its IUPAC name is [(7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [(7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 121387471 |
| Molecular Formula | C23H23F4NO6 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [(7aR)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@]3(c4cccc(F)c4)OCOC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C23H23F4NO6/c1-30-19-11-15(5-6-18(19)31-9-10-33-23(25,26)27)21(29)28-8-7-22(20(13-28)32-14-34-22)16-3-2-4-17(24)12-16/h2-6,11-12,20H,7-10,13-14H2,1H3/t20?,22-/m1/s1 |
| InChIKey | PVFGMAGLBYAXHL-LWMIZPGFSA-N |
| XLogP | 3.86 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|