C24H29NO6 — CID 121387293
[(7aR)-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]methanone (PubChem CID 121387293) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(7aR)-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]methanone.
| Compound Name | [(7aR)-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 121387293 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [(7aR)-7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC[C@]3(c4ccccc4)OCOC3C2)ccc1OCC(C)(C)O |
| InChI | InChI=1S/C24H29NO6/c1-23(2,27)15-29-19-10-9-17(13-20(19)28-3)22(26)25-12-11-24(18-7-5-4-6-8-18)21(14-25)30-16-31-24/h4-10,13,21,27H,11-12,14-16H2,1-3H3/t21?,24-/m1/s1 |
| InChIKey | GLVYSVCZHVRVCX-MQNHUJCZSA-N |
| XLogP | 2.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |