C25H27F2NO5 — CID 121387635
(7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[4-[(3,3-difluorocyclobutyl)methoxy]-3-methoxyphenyl]methanone (PubChem CID 121387635) has the molecular formula C25H27F2NO5 and a molecular weight of 459.49 g/mol. Its IUPAC name is (7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[4-[(3,3-difluorocyclobutyl)methoxy]-3-methoxyphenyl]methanone.
| Compound Name | (7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[4-[(3,3-difluorocyclobutyl)methoxy]-3-methoxyphenyl]methanone |
|---|---|
| PubChem CID | 121387635 |
| Molecular Formula | C25H27F2NO5 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (7a-phenyl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[4-[(3,3-difluorocyclobutyl)methoxy]-3-methoxyphenyl]methanone |
| SMILES | COc1cc(C(=O)N2CCC3(c4ccccc4)OCOC3C2)ccc1OCC1CC(F)(F)C1 |
| InChI | InChI=1S/C25H27F2NO5/c1-30-21-11-18(7-8-20(21)31-15-17-12-24(26,27)13-17)23(29)28-10-9-25(19-5-3-2-4-6-19)22(14-28)32-16-33-25/h2-8,11,17,22H,9-10,12-16H2,1H3 |
| InChIKey | BENOWOAKJGZNDN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |