C23H25F3N2O7 — CID 138473963
[(3aR,7aR)-7a-(6-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 138473963) has the molecular formula C23H25F3N2O7 and a molecular weight of 498.45 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(6-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(6-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 138473963 |
| Molecular Formula | C23H25F3N2O7 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [(3aR,7aR)-7a-(6-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | COc1cccc([C@]23CCN(C(=O)c4ccc(OCCOC(F)(F)F)c(OC)c4)C[C@H]2OCO3)n1 |
| InChI | InChI=1S/C23H25F3N2O7/c1-30-17-12-15(6-7-16(17)32-10-11-34-23(24,25)26)21(29)28-9-8-22(19(13-28)33-14-35-22)18-4-3-5-20(27-18)31-2/h3-7,12,19H,8-11,13-14H2,1-2H3/t19-,22-/m1/s1 |
| InChIKey | ZGDBSNIMBWNVPH-DENIHFKCSA-N |
| XLogP | 3.13 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|