C22H22ClF3N2O5 — CID 121387674
[7a-(3-chloro-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 121387674) has the molecular formula C22H22ClF3N2O5 and a molecular weight of 486.87 g/mol. Its IUPAC name is [7a-(3-chloro-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | [7a-(3-chloro-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 121387674 |
| Molecular Formula | C22H22ClF3N2O5 |
| Molecular Weight | 486.87 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [7a-(3-chloro-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-methyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC3(c4ncccc4Cl)OCOC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N2O5/c1-14-11-15(4-5-17(14)30-9-10-32-22(24,25)26)20(29)28-8-6-21(18(12-28)31-13-33-21)19-16(23)3-2-7-27-19/h2-5,7,11,18H,6,8-10,12-13H2,1H3 |
| InChIKey | YRLQIFFUCCEYRE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|