C24H29FN2O5 — CID 121387573
[7a-(3-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone (PubChem CID 121387573) has the molecular formula C24H29FN2O5 and a molecular weight of 444.50 g/mol. Its IUPAC name is [7a-(3-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone.
| Compound Name | [7a-(3-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone |
|---|---|
| PubChem CID | 121387573 |
| Molecular Formula | C24H29FN2O5 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [7a-(3-methoxy-2-pyridinyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone |
| SMILES | COc1cccnc1C12CCN(C(=O)c3ccc(OCC(C)(C)F)c(C)c3)CC1OCO2 |
| InChI | InChI=1S/C24H29FN2O5/c1-16-12-17(7-8-18(16)30-14-23(2,3)25)22(28)27-11-9-24(20(13-27)31-15-32-24)21-19(29-4)6-5-10-26-21/h5-8,10,12,20H,9,11,13-15H2,1-4H3 |
| InChIKey | PRSDXLMDXFTWRU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |