C21H25FN2O4S — CID 138473960
[(3aR,7aR)-7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone (PubChem CID 138473960) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone |
|---|---|
| PubChem CID | 138473960 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [(3aR,7aR)-7a-(1,3-thiazol-2-yl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[4-(2-fluoro-2-methylpropoxy)-3-methylphenyl]methanone |
| SMILES | Cc1cc(C(=O)N2CC[C@@]3(c4nccs4)OCO[C@@H]3C2)ccc1OCC(C)(C)F |
| InChI | InChI=1S/C21H25FN2O4S/c1-14-10-15(4-5-16(14)26-12-20(2,3)22)18(25)24-8-6-21(19-23-7-9-29-19)17(11-24)27-13-28-21/h4-5,7,9-10,17H,6,8,11-13H2,1-3H3/t17-,21-/m1/s1 |
| InChIKey | XKXLJGZUDZJYJX-DYESRHJHSA-N |
| XLogP | 3.69 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |