C23H24ClF2NO4 — CID 121387464
[(7aS)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2-fluoro-2-methylpropoxy)phenyl]methanone (PubChem CID 121387464) has the molecular formula C23H24ClF2NO4 and a molecular weight of 451.90 g/mol. Its IUPAC name is [(7aS)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2-fluoro-2-methylpropoxy)phenyl]methanone.
| Compound Name | [(7aS)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2-fluoro-2-methylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 121387464 |
| Molecular Formula | C23H24ClF2NO4 |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [(7aS)-7a-(3-fluorophenyl)-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2-fluoro-2-methylpropoxy)phenyl]methanone |
| SMILES | CC(C)(F)COc1ccc(C(=O)N2CC[C@@]3(c4cccc(F)c4)OCOC3C2)cc1Cl |
| InChI | InChI=1S/C23H24ClF2NO4/c1-22(2,26)13-29-19-7-6-15(10-18(19)24)21(28)27-9-8-23(20(12-27)30-14-31-23)16-4-3-5-17(25)11-16/h3-7,10-11,20H,8-9,12-14H2,1-2H3/t20?,23-/m0/s1 |
| InChIKey | PFCDUUXUNZHWQY-AKRCKQFNSA-N |
| XLogP | 4.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |