C21H19ClF4N2O4 — CID 150991519
[(3aR,7aR)-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone (PubChem CID 150991519) has the molecular formula C21H19ClF4N2O4 and a molecular weight of 474.84 g/mol. Its IUPAC name is [(3aR,7aR)-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 150991519 |
| Molecular Formula | C21H19ClF4N2O4 |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | [(3aR,7aR)-7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl]-[3-chloro-4-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)C(F)F)c(Cl)c1)N1CC[C@]2(c3ccccn3)OCO[C@@H]2C1 |
| InChI | InChI=1S/C21H19ClF4N2O4/c22-14-9-13(4-5-15(14)30-11-21(25,26)19(23)24)18(29)28-8-6-20(16-3-1-2-7-27-16)17(10-28)31-12-32-20/h1-5,7,9,17,19H,6,8,10-12H2/t17-,20-/m1/s1 |
| InChIKey | LSFHSASWRYKUBW-YLJYHZDGSA-N |
| XLogP | 4.13 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|