C22H22F4N2O5 — CID 121387577
(7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[3-fluoro-5-methoxy-4-(3,3,3-trifluoropropoxy)phenyl]methanone (PubChem CID 121387577) has the molecular formula C22H22F4N2O5 and a molecular weight of 470.42 g/mol. Its IUPAC name is (7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[3-fluoro-5-methoxy-4-(3,3,3-trifluoropropoxy)phenyl]methanone.
| Compound Name | (7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[3-fluoro-5-methoxy-4-(3,3,3-trifluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 121387577 |
| Molecular Formula | C22H22F4N2O5 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (7a-pyridin-2-yl-3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyridin-5-yl)-[3-fluoro-5-methoxy-4-(3,3,3-trifluoropropoxy)phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CCC3(c4ccccn4)OCOC3C2)cc(F)c1OCCC(F)(F)F |
| InChI | InChI=1S/C22H22F4N2O5/c1-30-16-11-14(10-15(23)19(16)31-9-6-22(24,25)26)20(29)28-8-5-21(17-4-2-3-7-27-17)18(12-28)32-13-33-21/h2-4,7,10-11,18H,5-6,8-9,12-13H2,1H3 |
| InChIKey | VNRACTYFAVYCGV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |